Benzoic acid,4-methoxy-, cyclopentyl ester
Modify Date: 2025-08-25 20:44:54
Benzoic acid,4-methoxy-, cyclopentyl ester structure
|
Common Name | Benzoic acid,4-methoxy-, cyclopentyl ester | ||
|---|---|---|---|---|
| CAS Number | 5421-01-2 | Molecular Weight | 220.26400 | |
| Density | 1.12g/cm3 | Boiling Point | 331ºC at 760mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6ºC | |
| Name | Phosphine,cyclopentylphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 331ºC at 760mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 136.6ºC |
| Exact Mass | 220.11000 |
| PSA | 35.53000 |
| LogP | 2.79460 |
| Index of Refraction | 1.531 |
| InChIKey | XVHVFWLEKAAUSQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OC2CCCC2)cc1 |
| HS Code | 2918990090 |
|---|
|
~72%
Benzoic acid,4-... CAS#:5421-01-2 |
| Literature: Amos, Richard A.; Emblidge, Robert W.; Havens, Nick Journal of Organic Chemistry, 1983 , vol. 48, # 20 p. 3598 - 3600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopentyl-phenylphosphin |
| cyclopentyl-p-methoxybenzoate |