Benzeneacetic acid, a-hydroxy-, heptyl ester structure
|
Common Name | Benzeneacetic acid, a-hydroxy-, heptyl ester | ||
|---|---|---|---|---|
| CAS Number | 5421-26-1 | Molecular Weight | 250.33300 | |
| Density | 1.045g/cm3 | Boiling Point | 359.5ºC at 760 mmHg | |
| Molecular Formula | C15H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143ºC | |
| Name | heptyl 2-hydroxy-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.045g/cm3 |
|---|---|
| Boiling Point | 359.5ºC at 760 mmHg |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33300 |
| Flash Point | 143ºC |
| Exact Mass | 250.15700 |
| PSA | 46.53000 |
| LogP | 3.23360 |
| Index of Refraction | 1.509 |
| InChIKey | XJVVNPAWWMPUJO-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)C(O)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| mandelic acid-heptyl ester |
| Mandelsaeure-heptylester |
| heptyl hydroxy(phenyl)acetate |