Benzeneacetic acid, a-hydroxy-a-phenyl-, ethyl ester structure
|
Common Name | Benzeneacetic acid, a-hydroxy-a-phenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 52182-15-7 | Molecular Weight | 256.29600 | |
| Density | 1,562 g/cm3 | Boiling Point | 192-194°C 12mm | |
| Molecular Formula | C16H16O3 | Melting Point | 29°C | |
| MSDS | N/A | Flash Point | 192-194°C/12mm | |
| Name | Ethyl Benzilate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,562 g/cm3 |
|---|---|
| Boiling Point | 192-194°C 12mm |
| Melting Point | 29°C |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 192-194°C/12mm |
| Exact Mass | 256.11000 |
| PSA | 46.53000 |
| LogP | 2.48560 |
| Index of Refraction | 1.5600 |
| InChIKey | AIPVNQQMYPWQSX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(O)(c1ccccc1)c1ccccc1 |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2918199090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl benzilate |
| ethyl 2-hydroxy-2,2-diphenylacetate |
| EINECS 257-713-7 |
| Benzilic Acid Ethyl Ester |
| Diphenylglycolic Acid Ethyl Ester |
| MFCD00016850 |