N-benzyl-N-(1-benzyl-2,5-dioxo-pyrrolidin-3-yl)acetamide structure
|
Common Name | N-benzyl-N-(1-benzyl-2,5-dioxo-pyrrolidin-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5422-95-7 | Molecular Weight | 336.38400 | |
| Density | 1.26g/cm3 | Boiling Point | 590.2ºC at 760 mmHg | |
| Molecular Formula | C20H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.4ºC | |
| Name | N-benzyl-N-(1-benzyl-2,5-dioxopyrrolidin-3-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 590.2ºC at 760 mmHg |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.38400 |
| Flash Point | 280.4ºC |
| Exact Mass | 336.14700 |
| PSA | 57.69000 |
| LogP | 2.30070 |
| Index of Refraction | 1.627 |
| InChIKey | CNKFWRHIVGSYBT-UHFFFAOYSA-N |
| SMILES | CC(=O)N(Cc1ccccc1)C1CC(=O)N(Cc2ccccc2)C1=O |
| HS Code | 2925290090 |
|---|
|
~%
N-benzyl-N-(1-b... CAS#:5422-95-7 |
| Literature: Liwschitz et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 3069,3071 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-Acetyl-N-benzyl-asparaginsaeure-benzylimid |
| HMS3078I05 |
| N-acetyl-N-benzyl-aspartic acid benzylimide |