1-[[2,4,6-Tris(isopropyl)phenyl]sulfonyl]-1H-1,2,4-triazole structure
|
Common Name | 1-[[2,4,6-Tris(isopropyl)phenyl]sulfonyl]-1H-1,2,4-triazole | ||
|---|---|---|---|---|
| CAS Number | 54230-60-3 | Molecular Weight | 335.464 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 451.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H25N3O2S | Melting Point | 111-114 °C | |
| MSDS | N/A | Flash Point | 227.1±31.5 °C | |
| Name | 1-[[2,4,6-Tris(Isopropyl)Phenyl]Sulphonyl]-1H-1,2,4-Triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.9±55.0 °C at 760 mmHg |
| Melting Point | 111-114 °C |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.464 |
| Flash Point | 227.1±31.5 °C |
| Exact Mass | 335.166748 |
| PSA | 73.23000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | BKJMMUUBRUWPPQ-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)n2cncn2)c(C(C)C)c1 |
| Storage condition | 2-8°C |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-1,2,4-triazole |
| 1-[(2,4,6-Triisopropylphenyl)sulfonyl]-1H-1,2,4-triazole |
| 1H-1,2,4-Triazole, 1-[[2,4,6-tris(1-methylethyl)phenyl]sulfonyl]- |
| MFCD00014089 |
| 1-((2,4,6-tris(isopropyl)phenyl)sulphonyl)-1h-1,2,4-triazole |
| EINECS 259-035-7 |