2-Propen-1-one,3-(2-chlorophenyl)-1-(4-hydroxyphenyl)- structure
|
Common Name | 2-Propen-1-one,3-(2-chlorophenyl)-1-(4-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5424-02-2 | Molecular Weight | 258.70000 | |
| Density | 1.292g/cm3 | Boiling Point | 449.9ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.9ºC | |
| Name | 3-(2-Chlorophenyl)-1-(4-hydroxyphenyl)-2-propen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 449.9ºC at 760 mmHg |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70000 |
| Flash Point | 225.9ºC |
| Exact Mass | 258.04500 |
| PSA | 37.30000 |
| LogP | 3.94170 |
| Index of Refraction | 1.659 |
| InChIKey | GTSKIPKSVPFFLB-JXMROGBWSA-N |
| SMILES | O=C(C=Cc1ccccc1Cl)c1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Chlor-4'-hydroxy-chalkon |
| 4'-hydroxy-2-chlorochalcone |
| 2-CHLORO-4'-HYDROXYCHALCONE |