4-((4-Hydroxyphenyl)diazenyl)phenylarsonic acid structure
|
Common Name | 4-((4-Hydroxyphenyl)diazenyl)phenylarsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5425-66-1 | Molecular Weight | 322.14800 | |
| Density | N/A | Boiling Point | 575.6ºC at 760 mmHg | |
| Molecular Formula | C12H11AsN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.9ºC | |
| Name | [4-[2-(4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 575.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H11AsN2O4 |
| Molecular Weight | 322.14800 |
| Flash Point | 301.9ºC |
| Exact Mass | 321.99300 |
| PSA | 102.48000 |
| LogP | 1.36860 |
| InChIKey | DJCIIHFJCDJYHI-UHFFFAOYSA-N |
| SMILES | O=[As](O)(O)c1ccc(N=Nc2ccc(O)cc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~60%
4-((4-Hydroxyph... CAS#:5425-66-1 |
| Literature: Cooper, Rachel J.; Camp, Philip J.; Gordon, Ross J.; Henderson, David K.; Henry, Dorothy C. R.; McNab, Hamish; De Silva, Sonali S.; Tackley, Daniel; Tasker, Peter A.; Wight, Paul Dalton Transactions, 2006 , # 23 p. 2785 - 2793 |
|
~%
4-((4-Hydroxyph... CAS#:5425-66-1 |
| Literature: Barrowcliff; Pyman; Remfry Journal of the Chemical Society, 1908 , vol. 93, p. 1900 Anm. |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4'-Hydroxy-4-arsono-azobenzol |
| [4-(4-Hydroxy-phenylazo)-phenyl]-arsonsaeure |
| 4-Oxy-azobenzol-arsinsaeure-(4') |
| 4-((4-Hydroxyphenyl)diazenyl)phenylarsonic acid |
| (Benzol-arsinsaeure-(4))-(1 azo 4)-phenol |
| 4-(4'-hydroxyphenylazo)phenylarsonic acid |