butoxycarbonylamino-cyclopropyl-acetic acid structure
|
Common Name | butoxycarbonylamino-cyclopropyl-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 54256-41-6 | Molecular Weight | 215.246 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 364.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4±23.2 °C | |
| Name | 2-(tert-Butoxycarbonylamino)-2-cyclopropylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.7±25.0 °C at 760 mmHg |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.246 |
| Flash Point | 174.4±23.2 °C |
| Exact Mass | 215.115753 |
| PSA | 75.63000 |
| LogP | 1.47 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | QFVJNEASAAJIDF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C1CC1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopropyl({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| butoxycarbonylamino-cyclopropyl-acetic acid |
| [(tert-Butoxycarbonyl)amino](cyclopropyl)acetic acid |
| Cyclopropaneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]- |