9-benzyl-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione structure
|
Common Name | 9-benzyl-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5426-69-7 | Molecular Weight | 302.35200 | |
| Density | 1.48g/cm3 | Boiling Point | 420.1ºC at 760 mmHg | |
| Molecular Formula | C14H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 9-benzyl-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 420.1ºC at 760 mmHg |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.35200 |
| Flash Point | 207.9ºC |
| Exact Mass | 302.08400 |
| PSA | 96.81000 |
| LogP | 1.14460 |
| Index of Refraction | 1.738 |
| InChIKey | JTXXGQPZZGMSMQ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(=S)n(Cc3ccccc3)c2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS3086D09 |
| 9-benzyl-1,3-dimethyl-8-thioxo-3,7,8,9-tetrahydro-1H-purine-2,6-dione |
| 9-Benzyl-1,3-dimethylxanthin-8-thion (4,R=SH) |
| 9-benzyl-1,3-dimethyl-8-thioxo-3,7,8,9-tetrahydro-purine-2,6-dione |