9-benzyl-1,3-dimethyl-purine-2,6-dione structure
|
Common Name | 9-benzyl-1,3-dimethyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7465-30-7 | Molecular Weight | 270.28700 | |
| Density | 1.33g/cm3 | Boiling Point | 489.6ºC at 760 mmHg | |
| Molecular Formula | C14H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | 9-benzyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 489.6ºC at 760 mmHg |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.28700 |
| Flash Point | 249.9ºC |
| Exact Mass | 270.11200 |
| PSA | 61.82000 |
| LogP | 0.48200 |
| Index of Refraction | 1.67 |
| InChIKey | YDBNSPHLNAWFNB-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2ncn(Cc3ccccc3)c2n(C)c1=O |
|
~%
9-benzyl-1,3-di... CAS#:7465-30-7 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
|
~%
9-benzyl-1,3-di... CAS#:7465-30-7 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Benzyl-1,3-dimethyl-3,9-dihydro-purin-2,6-dion |
| 9-Benzyltheophyllin |
| 9-Benzyl-1,3-dimethylxanthin |
| 9-benzyl-1,3-dimethyl-3,9-dihydro-purine-2,6-dione |