(+)-15-epi Cloprostenol structure
|
Common Name | (+)-15-epi Cloprostenol | ||
|---|---|---|---|---|
| CAS Number | 54276-22-1 | Molecular Weight | 424.915 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 628.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H29ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.6±31.5 °C | |
Use of (+)-15-epi CloprostenolCloprostenol is a synthetic prostaglandin F2α (PGF2α) analog and a potent FP receptor agonist. |
| Name | (+)-15-epi Cloprostenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.0±55.0 °C at 760 mmHg |
| Molecular Formula | C22H29ClO6 |
| Molecular Weight | 424.915 |
| Flash Point | 333.6±31.5 °C |
| Exact Mass | 424.165253 |
| PSA | 107.22000 |
| LogP | 2.31 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | VJGGHXVGBSZVMZ-HBWANGNJSA-N |
| SMILES | O=C(O)CCCC=CCC1C(O)CC(O)C1C=CC(O)COc1cccc(Cl)c1 |
| 5-Heptenoic acid, 7-[(2R)-2-[(1E,3S)-4-(3-chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-, (5Z)- |
| (5Z)-7-{(1R,2R,3R,5S)-2-[(1E,3S)-4-(3-Chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-5-heptenoic acid |
| (5Z)-7-{(2R)-2-[(1E,3S)-4-(3-Chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-5-heptenoic acid |
| D-Cloprostenol |
| 5-Heptenoic acid, 7-[(1R,2R,3R,5S)-2-[(1E,3S)-4-(3-chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-, (5Z)- |