1,3-Propanediol,2-nitro-2-phenyl- structure
|
Common Name | 1,3-Propanediol,2-nitro-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5428-02-4 | Molecular Weight | 197.18800 | |
| Density | 1.337g/cm3 | Boiling Point | 396ºC at 760 mmHg | |
| Molecular Formula | C9H11NO4 | Melting Point | 100-102ºC | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | 2-Nitro-2-phenylpropane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 396ºC at 760 mmHg |
| Melting Point | 100-102ºC |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.18800 |
| Flash Point | 175.7ºC |
| Exact Mass | 197.06900 |
| PSA | 86.28000 |
| LogP | 0.66640 |
| Index of Refraction | 1.58 |
| InChIKey | AJRYCRIQZBMNEO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(CO)(CO)c1ccccc1 |
|
~94%
1,3-Propanediol... CAS#:5428-02-4 |
| Literature: Hong, Mi Sook; Kim, Tae Woo; Jung, Byunghyuck; Kang, Sung Ho Chemistry - A European Journal, 2008 , vol. 14, # 11 p. 3290 - 3296 |
|
~%
1,3-Propanediol... CAS#:5428-02-4 |
| Literature: Fieser; Gates Journal of the American Chemical Society, 1946 , vol. 68, p. 2249,2250 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-nitro-2-phenylpropane-1,3-diol |