4-Quinolinol,3-bromo-2-(2-bromophenyl)-
Modify Date: 2025-10-04 22:05:01
4-Quinolinol,3-bromo-2-(2-bromophenyl)- structure
|
Common Name | 4-Quinolinol,3-bromo-2-(2-bromophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5428-23-9 | Molecular Weight | 379.04600 | |
| Density | 1.781g/cm3 | Boiling Point | 449.7ºC at 760mmHg | |
| Molecular Formula | C15H9Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8ºC | |
| Name | 3-bromo-2-(2-bromophenyl)-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.781g/cm3 |
|---|---|
| Boiling Point | 449.7ºC at 760mmHg |
| Molecular Formula | C15H9Br2NO |
| Molecular Weight | 379.04600 |
| Flash Point | 225.8ºC |
| Exact Mass | 376.90500 |
| PSA | 33.12000 |
| LogP | 5.13240 |
| Index of Refraction | 1.69 |
| InChIKey | DQWCAAWSQOPNKW-UHFFFAOYSA-N |
| SMILES | O=c1c(Br)c(-c2ccccc2Br)[nH]c2ccccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-bromo-2-(2-bromophenyl)quinolin-4(1h)-one |
| 3-Brom-4-hydroxy-2-(2-brom-phenyl)-chinolin |