N,N-bis(2-diethylaminoethyl)decanediamide structure
|
Common Name | N,N-bis(2-diethylaminoethyl)decanediamide | ||
|---|---|---|---|---|
| CAS Number | 5428-68-2 | Molecular Weight | 398.62600 | |
| Density | 0.953g/cm3 | Boiling Point | 585.2ºC at 760 mmHg | |
| Molecular Formula | C22H46N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.7ºC | |
| Name | N,N'-bis[2-(diethylamino)ethyl]decanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.953g/cm3 |
|---|---|
| Boiling Point | 585.2ºC at 760 mmHg |
| Molecular Formula | C22H46N4O2 |
| Molecular Weight | 398.62600 |
| Flash Point | 307.7ºC |
| Exact Mass | 398.36200 |
| PSA | 64.68000 |
| LogP | 3.80500 |
| Index of Refraction | 1.479 |
| InChIKey | QHPHBZRVOXLQRK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)CCCCCCCCC(=O)NCCN(CC)CC |
| HS Code | 2924199090 |
|---|
|
~%
N,N-bis(2-dieth... CAS#:5428-68-2 |
| Literature: Hromatka; Skopalik Monatshefte fuer Chemie, 1953 , vol. 84, p. 919,923 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-bis-(2-diethylamino-ethyl)-decanediamide |
| N,N'-Bis-(2-diaethylamino-aethyl)-decandiamid |