N,N-bis(2-diethylaminoethyl)oxamide structure
|
Common Name | N,N-bis(2-diethylaminoethyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 5432-13-3 | Molecular Weight | 286.41400 | |
| Density | 1.104g/cm3 | Boiling Point | 400.7ºC at 760 mmHg | |
| Molecular Formula | C14H30N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
| Name | N1,N2-bis(2-(diethylamino)ethyl)oxalamide |
|---|
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 400.7ºC at 760 mmHg |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.41400 |
| Flash Point | 196.2ºC |
| Exact Mass | 286.23700 |
| PSA | 64.68000 |
| LogP | 0.68420 |
| Index of Refraction | 1.576 |
| InChIKey | QQBJZFVHGHXOHQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C(=O)NCCN(CC)CC |
| HS Code | 2924199090 |
|---|
|
~%
N,N-bis(2-dieth... CAS#:5432-13-3 |
| Literature: Phillips Journal of the American Chemical Society, 1951 , vol. 73, p. 5822 |
|
~%
N,N-bis(2-dieth... CAS#:5432-13-3 |
| Literature: du Pont de Nemours and Co. Patent: US2438200 , 1946 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |