Carbamothioic acid,S-[2-[(4-methoxyphenyl)amino]-2-oxoethyl] ester structure
|
Common Name | Carbamothioic acid,S-[2-[(4-methoxyphenyl)amino]-2-oxoethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 5429-06-1 | Molecular Weight | 240.27900 | |
| Density | 1.351g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-[3-(2-ethylhexoxy)-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.27900 |
| Exact Mass | 240.05700 |
| PSA | 106.72000 |
| LogP | 2.21890 |
| Index of Refraction | 1.631 |
| InChIKey | HUCSOIGADMBWPJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)CSC(N)=O)cc1 |
| HS Code | 2930200090 |
|---|
|
~%
Carbamothioic a... CAS#:5429-06-1 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
|
~%
Carbamothioic a... CAS#:5429-06-1 |
| Literature: Beckurts; Frerichs Archiv der Pharmazie (Weinheim, Germany), 1915 , vol. 253, p. 157 |
| HS Code | 2930200090 |
|---|---|
| Summary | 2930200090 other thiocarbamates and dithiocarbamates。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (Carbaminyl-thioglykolsaeure)-p-anisidid |
| (4-(3-((2-Ethylhexyl)oxy)-2-hydroxypropoxy)-2-hydroxyphenyl) phenyl ketone |
| Carbamoylmercapto-essigsaeure-p-anisidid |
| (Aminoformyl-mercaptoessigsaeure)-p-anisidid |
| carbamoylsulfanyl-acetic acid p-anisidide |