S-[2-(naphthalen-2-ylamino)-2-oxoethyl] carbamothioate structure
|
Common Name | S-[2-(naphthalen-2-ylamino)-2-oxoethyl] carbamothioate | ||
|---|---|---|---|---|
| CAS Number | 5429-16-3 | Molecular Weight | 260.31200 | |
| Density | 1.385g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[2-(naphthalen-2-ylamino)-2-oxoethyl] carbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.31200 |
| Exact Mass | 260.06200 |
| PSA | 97.49000 |
| LogP | 3.36350 |
| Index of Refraction | 1.724 |
| InChIKey | NQFUVERKAWILHG-UHFFFAOYSA-N |
| SMILES | NC(=O)SCC(=O)Nc1ccc2ccccc2c1 |
|
~%
S-[2-(naphthale... CAS#:5429-16-3 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
|
~%
S-[2-(naphthale... CAS#:5429-16-3 |
| Literature: Frerichs; Wildt Justus Liebigs Annalen der Chemie, 1908 , vol. 360, p. 110 |
|
~%
S-[2-(naphthale... CAS#:5429-16-3 |
| Literature: Rheinboldt; Tappermann Journal fuer Praktische Chemie (Leipzig), 1939 , vol. <2> 153, p. 65,71, 72 |
| Carbamoylmercapto-essigsaeure-[2]naphthylamid |
| carbamoylsulfanyl-acetic acid-[2]naphthylamide |
| C-Carbamoylmercapto-N-(naphthyl-(2))-acetamid |