2-iodo-4,6-dinitroaniline structure
|
Common Name | 2-iodo-4,6-dinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 54292-20-5 | Molecular Weight | 309.01800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4IN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-4,6-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4IN3O4 |
|---|---|
| Molecular Weight | 309.01800 |
| Exact Mass | 308.92500 |
| PSA | 117.66000 |
| LogP | 3.31740 |
| InChIKey | MPNACQVROPIJCT-UHFFFAOYSA-N |
| SMILES | Nc1c(I)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
2-iodo-4,6-dini... CAS#:54292-20-5 |
| Literature: Joshi; Sane Journal of the Indian Chemical Society, 1933 , vol. 10, p. 459,462 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Jod-4,6-dinitro-anilin |
| 2-iodo-4,6-dinitro-aniline |
| Benzenamine,2-iodo-4,6-dinitro |