Arsonic acid,(4-cyanophenyl)- (9CI) structure
|
Common Name | Arsonic acid,(4-cyanophenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5430-22-8 | Molecular Weight | 227.04900 | |
| Density | N/A | Boiling Point | 522.8ºC at 760mmHg | |
| Molecular Formula | C7H6AsNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270ºC | |
| Name | (4-cyanophenyl)arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 522.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H6AsNO3 |
| Molecular Weight | 227.04900 |
| Flash Point | 270ºC |
| Exact Mass | 226.95600 |
| PSA | 81.32000 |
| InChIKey | YXVGFHKZFJNDAB-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc([As](=O)(O)O)cc1 |
|
~%
Arsonic acid,(4... CAS#:5430-22-8 |
| Literature: Linsker; Bogert Journal of the American Chemical Society, 1943 , vol. 65, p. 932 |
|
~%
Arsonic acid,(4... CAS#:5430-22-8 |
| Literature: Johnson, Bret J. S.; Buss, Carrie E.; Young Jr., Victor G.; Stein, Andreas Acta Crystallographica Section C: Crystal Structure Communications, 1999 , vol. 55, # 4 p. 549 - 551 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-Cyan-phenyl)-arsonsaeure |
| (4-cyano-phenyl)-arsonic acid |