[4-(methoxycarbonylmethoxy)phenyl]arsonic acid structure
|
Common Name | [4-(methoxycarbonylmethoxy)phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5430-35-3 | Molecular Weight | 290.10200 | |
| Density | N/A | Boiling Point | 505.5ºC at 760 mmHg | |
| Molecular Formula | C9H11AsO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | [4-(2-methoxy-2-oxoethoxy)phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 505.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H11AsO6 |
| Molecular Weight | 290.10200 |
| Flash Point | 200.6ºC |
| Exact Mass | 289.97700 |
| PSA | 93.06000 |
| InChIKey | CFOYEKKQTMEARK-UHFFFAOYSA-N |
| SMILES | COC(=O)COc1ccc([As](=O)(O)O)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
[4-(methoxycarb... CAS#:5430-35-3 |
| Literature: Jacobs; Heidelberger Journal of the American Chemical Society, 1919 , vol. 41, p. 1810 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (4-methoxycarbonylmethoxy-phenyl)-arsonic acid |
| (4-Methoxycarbonylmethoxy-phenyl)-arsonsaeure |
| 4-Arsono-phenoxyessigsaeure-methylester |