bis(4-methylphenyl)stibinic acid structure
|
Common Name | bis(4-methylphenyl)stibinic acid | ||
|---|---|---|---|---|
| CAS Number | 5430-43-3 | Molecular Weight | 337.02800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15O2Sb | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-methylphenyl)stibinic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15O2Sb |
|---|---|
| Molecular Weight | 337.02800 |
| Exact Mass | 336.01100 |
| PSA | 37.30000 |
| LogP | 3.29480 |
| InChIKey | BRFDRGFYKAPHLR-UHFFFAOYSA-M |
| SMILES | Cc1ccc([Sb](=O)(O)c2ccc(C)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
bis(4-methylphe... CAS#:5430-43-3 |
| Literature: Goddard, A. E.; Yarslev, V. E. Journal of the Chemical Society, 1928 , p. 719 - 723 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hydroxy[bis(4-methylphenyl)]stibane oxide |
| (4-CH3C6H4)2Sb(O)OH |