8-acetyl-12-hydroxyheptadec-10-enoic acid structure
|
Common Name | 8-acetyl-12-hydroxyheptadec-10-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 54314-72-6 | Molecular Weight | 326.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-acetyl-12-hydroxyheptadec-10-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H34O4 |
|---|---|
| Molecular Weight | 326.47100 |
| Exact Mass | 326.24600 |
| PSA | 74.60000 |
| LogP | 4.50430 |
| InChIKey | DTMHMUBDLJAQOS-UHFFFAOYSA-N |
| SMILES | CCCCCC(O)C=CCC(CCCCCCC(=O)O)C(C)=O |
|
~%
8-acetyl-12-hyd... CAS#:54314-72-6 |
| Literature: Merck and Co. Patent: DE2354085 , 1974 ; Chem.Abstr., 1974 , vol. 81, # 49328 |
|
~%
8-acetyl-12-hyd... CAS#:54314-72-6 |
| Literature: Merck and Co. Patent: DE2354085 , 1974 ; Chem.Abstr., 1974 , vol. 81, # 49328 |
|
~%
8-acetyl-12-hyd... CAS#:54314-72-6 |
| Literature: Merck and Co. Patent: DE2354085 , 1974 ; Chem.Abstr., 1974 , vol. 81, # 49328 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-acetyl-12-hydroxy-(E)-10-heptadecenoic acid |
| 10-Heptadecenoic acid,8-acetyl-12-hydroxy |
| 8-Acetyl-12-hydroxy-(E)-10-heptadecansaeure |