[3-(Benzyloxy)propyl]triphenylphosphonium Bromide structure
|
Common Name | [3-(Benzyloxy)propyl]triphenylphosphonium Bromide | ||
|---|---|---|---|---|
| CAS Number | 54314-85-1 | Molecular Weight | 491.399 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28BrOP | Melting Point | 153-154ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | triphenyl(3-phenylmethoxypropyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 153-154ºC(lit.) |
|---|---|
| Molecular Formula | C28H28BrOP |
| Molecular Weight | 491.399 |
| Exact Mass | 490.106110 |
| PSA | 22.82000 |
| LogP | 2.59140 |
| InChIKey | DWYCJWXMZGVGJV-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc(COCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonium, triphenyl[3-(phenylmethoxy)propyl]-, bromide (1:1) |
| MFCD00191781 |
| [3-(Benzyloxy)propyl](triphenyl)phosphonium bromide |