4-[[(E)-3-carboxyprop-2-enoyl]amino]benzoic acid structure
|
Common Name | 4-[[(E)-3-carboxyprop-2-enoyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5432-04-2 | Molecular Weight | 235.19300 | |
| Density | 1.504g/cm3 | Boiling Point | 564.7ºC at 760mmHg | |
| Molecular Formula | C11H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[(E)-3-carboxyprop-2-enoyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.504g/cm3 |
|---|---|
| Boiling Point | 564.7ºC at 760mmHg |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19300 |
| Exact Mass | 235.04800 |
| PSA | 103.70000 |
| LogP | 1.03710 |
| Index of Refraction | 1.669 |
| InChIKey | KDCFOKATFSLHQS-WAYWQWQTSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(C(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-carboxymaleanilic acid |
| 4-maleamidobenzoic acid |