ethyl N-(2,4-dinitrophenoxy)ethanimidate structure
|
Common Name | ethyl N-(2,4-dinitrophenoxy)ethanimidate | ||
|---|---|---|---|---|
| CAS Number | 54322-32-6 | Molecular Weight | 269.21100 | |
| Density | 1.4g/cm3 | Boiling Point | 377.8ºC at 760 mmHg | |
| Molecular Formula | C10H11N3O6 | Melting Point | 112-114ºC | |
| MSDS | USA | Flash Point | 182.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl N-(2,4-dinitrophenoxy)ethanimidate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 377.8ºC at 760 mmHg |
| Melting Point | 112-114ºC |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21100 |
| Flash Point | 182.3ºC |
| Exact Mass | 269.06500 |
| PSA | 122.46000 |
| LogP | 3.29810 |
| Index of Refraction | 1.569 |
| InChIKey | UVBZLMGBNXCYNA-YRNVUSSQSA-N |
| SMILES | CCOC(C)=NOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
|
~%
ethyl N-(2,4-di... CAS#:54322-32-6 |
| Literature: Helvetica Chimica Acta, , vol. 46, p. 2009 - 2020 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| ethyl N-(2,4-dinitrophenoxy)acetimidate |
| N-(2,4-dinitrophenoxy)ethanimidic acid ethyl ester |
| EINECS 259-095-4 |
| O-(2,4-Dinitro-phenyl)-acethydroximsaeure-ethylester |
| Ethanimidic acid,N-(2,4-dinitrophenoxy)-,ethyl ester |
| MFCD00010133 |
| ethyl N-(2,4-dinitrophenoxy)thioacetate |