ethyl 4-[(3,3-diethoxy-2-hydroxy-propyl)-(4-methylphenyl)sulfonyl-amino]benzoate structure
|
Common Name | ethyl 4-[(3,3-diethoxy-2-hydroxy-propyl)-(4-methylphenyl)sulfonyl-amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 5433-15-8 | Molecular Weight | 465.56000 | |
| Density | 1.232g/cm3 | Boiling Point | 604.2ºC at 760 mmHg | |
| Molecular Formula | C23H31NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.2ºC | |
| Name | ethyl 4-[(3,3-diethoxy-2-hydroxypropyl)-(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 604.2ºC at 760 mmHg |
| Molecular Formula | C23H31NO7S |
| Molecular Weight | 465.56000 |
| Flash Point | 319.2ºC |
| Exact Mass | 465.18200 |
| PSA | 110.75000 |
| LogP | 4.20780 |
| Index of Refraction | 1.558 |
| InChIKey | AMCFRLYHGIADQW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N(CC(O)C(OCC)OCC)S(=O)(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
ethyl 4-[(3,3-d... CAS#:5433-15-8 |
| Literature: Weisblat et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 5893,5895 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-[(3,3-diethoxy-2-hydroxy-propyl)-(toluene-4-sulfonyl)-amino]-benzoic acid ethyl ester |
| 4-[(3,3-Diaethoxy-2-hydroxy-propyl)-(toluol-4-sulfonyl)-amino]-benzoesaeure-aethylester |
| ethyl 4-{(3,3-diethoxy-2-hydroxypropyl)[(4-methylphenyl)sulfonyl]amino}benzoate |