benzhydrylsulfonylbenzene structure
|
Common Name | benzhydrylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 5433-76-1 | Molecular Weight | 308.39400 | |
| Density | 1.205g/cm3 | Boiling Point | 504.4ºC at 760 mmHg | |
| Molecular Formula | C19H16O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.7ºC | |
| Name | [benzenesulfonyl(phenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 504.4ºC at 760 mmHg |
| Molecular Formula | C19H16O2S |
| Molecular Weight | 308.39400 |
| Flash Point | 316.7ºC |
| Exact Mass | 308.08700 |
| PSA | 42.52000 |
| LogP | 5.33070 |
| Index of Refraction | 1.617 |
| InChIKey | QIDAQLGNZCUYBP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| HS Code | 2904100000 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1-diphenyl-1-phenylsulfonylmethane |
| diphenylmethyl phenylsulfone |
| benzhydryl-phenyl sulfone |
| BENZHYDRYLSULFONYLBENZENE |
| Benzhydryl-phenyl-sulfon |
| Diphenylmethyl-phenyl-sulfon |