2-[(phenylsulfonyl)oxy]-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione structure
|
Common Name | 2-[(phenylsulfonyl)oxy]-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione | ||
|---|---|---|---|---|
| CAS Number | 5433-80-7 | Molecular Weight | 319.33200 | |
| Density | 1.57g/cm3 | Boiling Point | 477.2ºC at 760 mmHg | |
| Molecular Formula | C15H13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.4ºC | |
| Name | 2-[(phenylsulfonyl)oxy]-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 477.2ºC at 760 mmHg |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.33200 |
| Flash Point | 242.4ºC |
| Exact Mass | 319.05100 |
| PSA | 89.13000 |
| LogP | 2.13270 |
| Index of Refraction | 1.679 |
| InChIKey | PUHPXRCIMAHURH-UHFFFAOYSA-N |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1OS(=O)(=O)c1ccccc1 |
|
~%
2-[(phenylsulfo... CAS#:5433-80-7 |
| Literature: Bauer; Miarka Journal of Organic Chemistry, 1959 , vol. 24, p. 1293,1295 |
|
~%
2-[(phenylsulfo... CAS#:5433-80-7 |
| Literature: Bauer; Miarka Journal of Organic Chemistry, 1959 , vol. 24, p. 1293,1295 |
| cis-N-sulphonyloxy-5-norbornene-endo-2,3-dicarboximide |