Carbic anhydride structure
|
Common Name | Carbic anhydride | ||
|---|---|---|---|---|
| CAS Number | 129-64-6 | Molecular Weight | 164.158 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 331.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H8O3 | Melting Point | 165-167 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 163.8±25.1 °C | |
| Symbol |
GHS05, GHS08 |
Signal Word | Danger | |
| Name | Cis-5-Norbornene-Endo-2,3-Dicarboxylic |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.1±42.0 °C at 760 mmHg |
| Melting Point | 165-167 °C(lit.) |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| Flash Point | 163.8±25.1 °C |
| Exact Mass | 164.047348 |
| PSA | 43.37000 |
| LogP | -0.04 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | KNDQHSIWLOJIGP-UMRXKNAASA-N |
| SMILES | O=C1OC(=O)C2C3C=CC(C3)C12 |
| Water Solubility | DECOMPOSES |
| Symbol |
GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H334 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R41;R42/43 |
| Safety Phrases | S22-S24-S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DT5600000 |
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Therapeutic effects of cantharidin analogues without bridging ether oxygen on human hepatocellular carcinoma cells.
Eur. J. Med. Chem. 45 , 3981-5, (2010) Previous research indicates that cantharidin, norcantharidin and their analogues exhibit anticancer activity due to their inhibition of cancer cell lines such as HL60, HT29 and L1210. The anticancer a... |
| EINECS 204-957-7 |
| cis-5-Norbornene-endo-2,3-dicarboxylic anhydride |
| (3aR,4S,7R,7aS)-rel-3a,4,7,7a-Tetrahydro-4,7-methanoisobenzofuran-1,3-dione |
| MFCD00151106 |
| Carbic anhydride |
| 2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enecarboxylic anhydride |