9H-Purine,6-[[(4-nitrophenyl)methyl]thio]- structure
|
Common Name | 9H-Purine,6-[[(4-nitrophenyl)methyl]thio]- | ||
|---|---|---|---|---|
| CAS Number | 5434-26-4 | Molecular Weight | 287.29700 | |
| Density | 1.6g/cm3 | Boiling Point | 492.1ºC at 760 mmHg | |
| Molecular Formula | C12H9N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4ºC | |
| Name | 6-[(4-nitrophenyl)methylsulfanyl]-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 492.1ºC at 760 mmHg |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.29700 |
| Flash Point | 251.4ºC |
| Exact Mass | 287.04800 |
| PSA | 125.58000 |
| LogP | 3.07660 |
| Index of Refraction | 1.791 |
| InChIKey | UBRDHOJAHBCLCW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CSc2ncnc3nc[nH]c23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(4-nitrobenzylsulfanyl)purine |
| 6-(4-Nitrobenzylmercapto)-purin |
| 6-(p-Nitro-benzylmercapto)-purin |
| 6-[(4-nitrobenzyl)sulfanyl]-9H-purine |
| 6-(4-nitrobenzylthio)-purine |
| 6-(4-nitro-benzylsulfanyl)-7(9)H-purine |
| nitrobenzylmercaptopurine |