2(5H)-Furanone,4-hydroxy-3,5-diphenyl- structure
|
Common Name | 2(5H)-Furanone,4-hydroxy-3,5-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 5435-01-8 | Molecular Weight | 252.26500 | |
| Density | 1.321g/cm3 | Boiling Point | 437.9ºC at 760 mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | 3-hydroxy-2,4-diphenyl-2H-furan-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 437.9ºC at 760 mmHg |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 167.2ºC |
| Exact Mass | 252.07900 |
| PSA | 46.53000 |
| LogP | 3.25380 |
| Index of Refraction | 1.657 |
| InChIKey | QOZLFBARPXJJFW-UHFFFAOYSA-N |
| SMILES | O=C1OC(c2ccccc2)C(O)=C1c1ccccc1 |
| HS Code | 2932209090 |
|---|
|
~%
2(5H)-Furanone,... CAS#:5435-01-8 |
| Literature: Krepski, Larry R.; Lynch, Laurie E.; Heilmann, Steven M.; Rasmussem, Jerald K. Tetrahedron Letters, 1985 , vol. 26, # 8 p. 981 - 984 |
|
~%
2(5H)-Furanone,... CAS#:5435-01-8 |
| Literature: Bickel Journal of the American Chemical Society, 1946 , vol. 68, p. 941 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-hydroxy-2,4-diphenylfuran-3-one |
| 5-hydroxy-2,4-diphenylfuran-3(2h)-one |
| 2(5H)-Furanone,4-hydroxy-3,5-diphenyl |
| HMS3089J18 |