ALPHA-(TRIMETHYLSILYLOXY)PHENYLACETONIT& structure
|
Common Name | ALPHA-(TRIMETHYLSILYLOXY)PHENYLACETONIT& | ||
|---|---|---|---|---|
| CAS Number | 25438-37-3 | Molecular Weight | 205.32800 | |
| Density | 0.978 g/mL at 25ºC(lit.) | Boiling Point | 91ºC0.5 mm Hg(lit.) | |
| Molecular Formula | C11H15NOSi | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 221 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-phenyl-2-trimethylsilyloxyacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 91ºC0.5 mm Hg(lit.) |
| Molecular Formula | C11H15NOSi |
| Molecular Weight | 205.32800 |
| Flash Point | 221 °F |
| Exact Mass | 205.09200 |
| PSA | 33.02000 |
| LogP | 3.10278 |
| Vapour Pressure | 0.021mmHg at 25°C |
| Index of Refraction | 0.978 |
| InChIKey | DTAFQWDNWAXRLX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(C#N)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S23;S27;S45;S36/S37/S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phenyl-trimethylsilanyloxy-acetonitrile |
| Acetonitrile,2-phenyl-2-trimethylsilyloxy |
| MFCD02295646 |
| 2-phenyl-2-trimethylsiloxyethanenitrile |