4-methyl-N-(3-phenylpropyl)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(3-phenylpropyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5435-02-9 | Molecular Weight | 289.39300 | |
| Density | 1.157g/cm3 | Boiling Point | 442.8ºC at 760 mmHg | |
| Molecular Formula | C16H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | 4-methyl-N-(3-phenylpropyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 442.8ºC at 760 mmHg |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.39300 |
| Flash Point | 221.6ºC |
| Exact Mass | 289.11400 |
| PSA | 54.55000 |
| LogP | 4.37780 |
| Index of Refraction | 1.573 |
| InChIKey | SZTOLUUHYDAAFU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCCc2ccccc2)cc1 |
| HS Code | 2935009090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| N-p-toluenesulfonyl-3-phenylpropylamine |