bis(2,4-dibromophenyl) ether structure
|
Common Name | bis(2,4-dibromophenyl) ether | ||
|---|---|---|---|---|
| CAS Number | 5436-43-1 | Molecular Weight | 485.791 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 395.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Br4O | Melting Point | 83-84℃ (ethanol ) | |
| MSDS | N/A | Flash Point | 162.8±26.4 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 2,2’,4,4Tetrabromodiphenyl Ether |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.5±42.0 °C at 760 mmHg |
| Melting Point | 83-84℃ (ethanol ) |
| Molecular Formula | C12H6Br4O |
| Molecular Weight | 485.791 |
| Flash Point | 162.8±26.4 °C |
| Exact Mass | 481.715179 |
| PSA | 9.23000 |
| LogP | 7.39 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | XYBSIYMGXVUVGY-UHFFFAOYSA-N |
| SMILES | Brc1ccc(Oc2ccc(Br)cc2Br)c(Br)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Phrases | 11-38-50/53-65-67 |
| Safety Phrases | 60-61-62 |
| RIDADR | UN 1262 3/PG 2 |
| HS Code | 2903999090 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Oxybis(2,4-dibromobenzene) |
| bis(2,4-dibromophenyl) ether |
| 2,2'4,4'-Tetrabromodiphenyl ether |
| Benzene, 1,1'-oxybis[2,4-dibromo- |
| 2,4-dibromo-1-(2,4-dibromophenoxy)benzene |
| 2,2',4,4'-TetraBDE |