1-Propanol,2-nitro-, 1-benzoate structure
|
Common Name | 1-Propanol,2-nitro-, 1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 5437-73-0 | Molecular Weight | 209.19900 | |
| Density | 1.205g/cm3 | Boiling Point | 331.2ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.1ºC | |
| Name | 2-nitropropyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 331.2ºC at 760mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 150.1ºC |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.03180 |
| Index of Refraction | 1.526 |
| InChIKey | KSAIPBINPVHIPW-UHFFFAOYSA-N |
| SMILES | CC(COC(=O)c1ccccc1)[N+](=O)[O-] |
|
~%
1-Propanol,2-ni... CAS#:5437-73-0 |
| Literature: Blomquist; Tapp; Johnson Journal of the American Chemical Society, 1945 , vol. 67, p. 1519,1522 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1-Propanol,2-nitro-,1-benzoate |