dodec-1-en-3-yl 2,2,2-trifluoroacetate
dodec-1-en-3-yl 2,2,2-trifluoroacetate structure
|
Common Name | dodec-1-en-3-yl 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 543717-25-5 | Molecular Weight | 280.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dodec-1-en-3-yl 2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H23F3O2 |
|---|---|
| Molecular Weight | 280.32600 |
| Exact Mass | 280.16500 |
| PSA | 26.30000 |
| LogP | 4.78720 |
| InChIKey | WDYOQIARBJANHU-UHFFFAOYSA-N |
| SMILES | C=CC(CCCCCCCCC)OC(=O)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
dodec-1-en-3-yl... CAS#:543717-25-5 |
| Literature: Itami, Kenichiro; Terakawa, Koji; Yoshida, Jun-Ichi; Kajimoto, Okitsugu Bulletin of the Chemical Society of Japan, 2004 , vol. 77, # 11 p. 2071 - 2080 |
|
~%
dodec-1-en-3-yl... CAS#:543717-25-5 |
| Literature: Itami, Kenichiro; Terakawa, Koji; Yoshida, Jun-Ichi; Kajimoto, Okitsugu Bulletin of the Chemical Society of Japan, 2004 , vol. 77, # 11 p. 2071 - 2080 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-trifluoroacetoxy-1-dodecene |
| Acetic acid,trifluoro-,1-ethenyldecyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: The English name of dodec-1-en-3-yl 2,2,2-trifluoroacetate is dodec-1-en-3-yl 2,2,2-trifluoroacetate. |
| Q: What is the InChIKey of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: InChIKey of dodec-1-en-3-yl 2,2,2-trifluoroacetate is WDYOQIARBJANHU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 543717-25-5? |
| A: Chinese name of 543717-25-5 is 543717-25-5. |
| Q: What are the upstream materials of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: Related upstream materials(CAS) of dodec-1-en-3-yl 2,2,2-trifluoroacetate: 4048-42-4;407-25-0;112-31-2. |
| Q: What is the CAS number of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: CAS number of dodec-1-en-3-yl 2,2,2-trifluoroacetate is 543717-25-5. |
| Q: What is the molecular formula of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: Molecular formula of dodec-1-en-3-yl 2,2,2-trifluoroacetate is C14H23F3O2. |
| Q: What is the molecular weight of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: Molecular weight of dodec-1-en-3-yl 2,2,2-trifluoroacetate is 280.32600. |
| Q: What is the LogP of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: LogP of dodec-1-en-3-yl 2,2,2-trifluoroacetate is 4.78720. |
| Q: What is the polar surface area (PSA) of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: Polar surface area (PSA) of dodec-1-en-3-yl 2,2,2-trifluoroacetate is 26.30000. |
| Q: What is the SMILES notation of dodec-1-en-3-yl 2,2,2-trifluoroacetate? |
| A: SMILES notation of dodec-1-en-3-yl 2,2,2-trifluoroacetate is C=CC(CCCCCCCCC)OC(=O)C(F)(F)F. |