3-chloro-N-[6-(3-chloropropanoylamino)hexyl]propanamide structure
|
Common Name | 3-chloro-N-[6-(3-chloropropanoylamino)hexyl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 54378-03-9 | Molecular Weight | 297.22100 | |
| Density | 1.137g/cm3 | Boiling Point | 541.6ºC at 760 mmHg | |
| Molecular Formula | C12H22Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.4ºC | |
| Name | 1,6-bis-(3-chloro-propionylamino)-hexane |
|---|
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 541.6ºC at 760 mmHg |
| Molecular Formula | C12H22Cl2N2O2 |
| Molecular Weight | 297.22100 |
| Flash Point | 281.4ºC |
| Exact Mass | 296.10600 |
| PSA | 58.20000 |
| LogP | 2.81880 |
| Index of Refraction | 1.482 |
| InChIKey | KYRIMKLUBAFBLV-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)NCCCCCCNC(=O)CCCl |
|
~%
3-chloro-N-[6-(... CAS#:54378-03-9 |
| Literature: Kazlauskas,D.A.; Ramoshkene,E.B. Journal of Organic Chemistry USSR (English Translation), 1974 , vol. 10, p. 2316 - 2318 Zhurnal Organicheskoi Khimii, 1974 , vol. 10, p. 2301 - 2303 |
|
~%
3-chloro-N-[6-(... CAS#:54378-03-9 |
| Literature: I.G. Farbenind. Patent: DE743466 , 1939 ; DRP/DRBP Org.Chem. |