1,2-bis(4-hydroxy-3-methoxy-phenyl)ethanone structure
|
Common Name | 1,2-bis(4-hydroxy-3-methoxy-phenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 5438-67-5 | Molecular Weight | 288.29500 | |
| Density | 1.272g/cm3 | Boiling Point | 506ºC at 760 mmHg | |
| Molecular Formula | C16H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | 1,2-bis(4-hydroxy-3-methoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 506ºC at 760 mmHg |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29500 |
| Flash Point | 189.2ºC |
| Exact Mass | 288.10000 |
| PSA | 75.99000 |
| LogP | 2.54040 |
| Index of Refraction | 1.603 |
| InChIKey | URFHJEVBFJOWKL-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(=O)c2ccc(O)c(OC)c2)ccc1O |
|
~%
1,2-bis(4-hydro... CAS#:5438-67-5 |
| Literature: Pearl Journal of the American Chemical Society, 1952 , vol. 74, p. 4593 |
|
~%
1,2-bis(4-hydro... CAS#:5438-67-5 |
| Literature: Ley, Jakob P.; Dessoy, Marco; Paetz, Susanne; Blings, Maria; Hoffmann-Luecke, Petra; Reichelt, Katharina V.; Krammer, Gerhard E.; Pienkny, Silke; Brandt, Wolfgang; Wessjohann, Ludger Journal of Agricultural and Food Chemistry, 2012 , vol. 60, # 25 p. 6303 - 6311 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4'-Dihydroxy-3,3'-dimethoxy-desoxybenzoin |
| 4,4'-dihydroxy-3,3'-dimethoxy-deoxybenzoin |