1,2-Bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione structure
|
Common Name | 1,2-Bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 5463-22-9 | Molecular Weight | 302.27900 | |
| Density | 1.342g/cm3 | Boiling Point | 555.8ºC at 760 mmHg | |
| Molecular Formula | C16H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 555.8ºC at 760 mmHg |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.27900 |
| Flash Point | 209.2ºC |
| Exact Mass | 302.07900 |
| PSA | 93.06000 |
| LogP | 2.18060 |
| Index of Refraction | 1.612 |
| InChIKey | MJHMXBDRUWSJOS-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)C(=O)c2ccc(O)c(OC)c2)ccc1O |
| Storage condition | 2-8°C |
|
~%
1,2-Bis(4-hydro... CAS#:5463-22-9 |
| Literature: Pearl Journal of the American Chemical Society, 1952 , vol. 74, p. 4260 |
|
~%
1,2-Bis(4-hydro... CAS#:5463-22-9 |
| Literature: Pearl Journal of the American Chemical Society, 1952 , vol. 74, p. 4260 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| 4,4'-Dihydroxy-3,3'-dimethoxy-benzil |
| Vanillil |