2,2-dichloro-N,N-dipentyl-acetamide structure
|
Common Name | 2,2-dichloro-N,N-dipentyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 5439-40-7 | Molecular Weight | 268.22300 | |
| Density | 1.055g/cm3 | Boiling Point | 324.8ºC at 760 mmHg | |
| Molecular Formula | C12H23Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.3ºC | |
| Name | 2,2-dichloro-N,N-dipentylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 324.8ºC at 760 mmHg |
| Molecular Formula | C12H23Cl2NO |
| Molecular Weight | 268.22300 |
| Flash Point | 150.3ºC |
| Exact Mass | 267.11600 |
| PSA | 20.31000 |
| LogP | 3.99910 |
| Index of Refraction | 1.471 |
| InChIKey | GNTUWTVWBOKJHO-UHFFFAOYSA-N |
| SMILES | CCCCCN(CCCCC)C(=O)C(Cl)Cl |
|
~%
2,2-dichloro-N,... CAS#:5439-40-7 |
| Literature: Swensen; Weaver Journal of the American Chemical Society, 1948 , vol. 70, p. 4060 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dichlor-essigsaeure-dipentylamid |
| dichloro-acetic acid dipentylamide |
| N.N-Dipentyl-dichloracetamid |