PhD structure
|
Common Name | PhD | ||
|---|---|---|---|---|
| CAS Number | 54397-85-2 | Molecular Weight | 370.480 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 582.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.7±23.6 °C | |
Use of PhDThromboxane B2 is a prostaglandin derivative that is released during anaphylaxis. Thromboxane B2 induces arterial contraction and platelet aggregation. |
| Name | thromboxane B2 |
|---|---|
| Synonym | More Synonyms |
| Description | Thromboxane B2 is a prostaglandin derivative that is released during anaphylaxis. Thromboxane B2 induces arterial contraction and platelet aggregation. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.5±50.0 °C at 760 mmHg |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.480 |
| Flash Point | 199.7±23.6 °C |
| Exact Mass | 370.235535 |
| PSA | 107.22000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | XNRNNGPBEPRNAR-JQBLCGNGSA-N |
| SMILES | CCCCCC(O)C=CC1OC(O)CC(O)C1CC=CCCCC(=O)O |
| Storage condition | -20°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R63 |
| Safety Phrases | 22-36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (5Z,9β,13E,15S)-9,11,15-Trihydroxythromboxa-5,13-dien-1-oic acid |
| D-erythro-Pentopyranose, 4-[(2Z)-6-carboxy-2-hexen-1-yl]-2,4-dideoxy-5-C-[(1E,3S)-3-hydroxy-1-octen-1-yl]-, (5R)- |
| Thromboxa-5,13-dien-1-oic acid, 9,11,15-trihydroxy-, (5Z,9α,13E,15S)- |
| (5Z,9a,13E,15S)-9,11,15-trihydroxythromboxa-5,13-dien-1-oic Acid |
| [2R-[2a(1E,3S*),3b(Z),4b,6a]]-7-[Tetrahydro-4,6-dihydroxy-2-(3-hydroxy-1-octenyl)-2H-pyran-3-yl]-5-heptenoic Acid |
| THROMBOXANE B2 |
| PhD |
| MFCD00036822 |