Sercloremine hydrochloride structure
|
Common Name | Sercloremine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 54403-20-2 | Molecular Weight | 286.19700 | |
| Density | N/A | Boiling Point | 345.9ºC at 760 mmHg | |
| Molecular Formula | C14H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
Use of Sercloremine hydrochlorideA selective, reversible inhibitor of MAO-A and serotonin reuptake inhibitor as an antidepressant.. |
| Name | 4-(5-chloro-1-benzofuran-2-yl)-1-methylpiperidine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 345.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.19700 |
| Flash Point | 163ºC |
| Exact Mass | 285.06900 |
| PSA | 16.38000 |
| LogP | 4.63530 |
| InChIKey | RTLGMUXJYFSHMM-UHFFFAOYSA-N |
| SMILES | CN1CCC(c2cc3cc(Cl)ccc3o2)CC1.Cl |
| Piperidine,4-(5-chloro-2-benzofuranyl)-1-methyl-,hydrochloride |
| Sercloremine hydrochloride |
| Cgp 4718 A |