Benzenamine,4-[2-(4,6-dimethyl-2-quinolinyl)ethenyl]-N,N-dimethyl- structure
|
Common Name | Benzenamine,4-[2-(4,6-dimethyl-2-quinolinyl)ethenyl]-N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 5442-96-6 | Molecular Weight | 302.41300 | |
| Density | 1.117g/cm3 | Boiling Point | 477.9ºC at 760mmHg | |
| Molecular Formula | C21H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.8ºC | |
| Name | Benzenamine, 4-[2-(4,6-dimethyl-2-quinolinyl)ethenyl]- N,N-dimethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 477.9ºC at 760mmHg |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.41300 |
| Flash Point | 242.8ºC |
| Exact Mass | 302.17800 |
| PSA | 16.13000 |
| LogP | 5.08800 |
| Index of Refraction | 1.691 |
| InChIKey | UUOAUBAEXRHSQV-RMKNXTFCSA-N |
| SMILES | Cc1ccc2nc(C=Cc3ccc(N(C)C)cc3)cc(C)c2c1 |
| HS Code | 2933499090 |
|---|
|
~%
Benzenamine,4-[... CAS#:5442-96-6 |
| Literature: Tipson Journal of the American Chemical Society, 1945 , vol. 67, p. 507,508, 510 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzamide,N-(4-aminobutyl)-4-azido-2-hydroxy |
| BIPA116 |
| 4,6-dimethyl-2-(p-N,N-dimethylaminostyryl)quinoline |
| 4-[p-azidosalicylamido]butylamine |
| 4-(4-Azidosalicylamido)butylamine |