2-(4-phenacylpiperazin-1-yl)-1-phenyl-ethanone structure
|
Common Name | 2-(4-phenacylpiperazin-1-yl)-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 5443-06-1 | Molecular Weight | 322.40100 | |
| Density | 1.141g/cm3 | Boiling Point | 491.2ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | 2-(4-phenacylpiperazin-1-yl)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 491.2ºC at 760 mmHg |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.40100 |
| Flash Point | 213.7ºC |
| Exact Mass | 322.16800 |
| PSA | 40.62000 |
| LogP | 2.24560 |
| Index of Refraction | 1.58 |
| InChIKey | JYZWZUZEXDJDHQ-UHFFFAOYSA-N |
| SMILES | O=C(CN1CCN(CC(=O)c2ccccc2)CC1)c1ccccc1 |
|
~%
2-(4-phenacylpi... CAS#:5443-06-1 |
| Literature: Lutz; Shearer Journal of Organic Chemistry, 1947 , vol. 12, p. 771,773 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1'-diphenyl-2,2'-piperazine-1,4-diyl-bis-ethanone |
| 1,1'-Diphenyl-2,2'-piperazin-1,4-diyl-bis-aethanon |