5-chloro-2-(4-fluorophenyl)sulfanylbenzoic acid structure
|
Common Name | 5-chloro-2-(4-fluorophenyl)sulfanylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 54435-13-1 | Molecular Weight | 282.71800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8ClFO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-2-(4-fluorophenyl)sulfanylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8ClFO2S |
|---|---|
| Molecular Weight | 282.71800 |
| Exact Mass | 281.99200 |
| PSA | 62.60000 |
| LogP | 4.32850 |
| InChIKey | LPMSAUSFYFJZIN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)ccc1Sc1ccc(F)cc1 |
|
~%
5-chloro-2-(4-f... CAS#:54435-13-1 |
| Literature: Hoffmann-la Roche Inc. Patent: US3954764 A1, 1976 ; |
|
~%
5-chloro-2-(4-f... CAS#:54435-13-1 |
| Literature: Rajsner; Metysova; Svatek; et al. Collection of Czechoslovak Chemical Communications, 1975 , vol. 40, # 3 p. 719 - 737 |
|
~%
5-chloro-2-(4-f... CAS#:54435-13-1 |
| Literature: Rajsner; Metysova; Svatek; et al. Collection of Czechoslovak Chemical Communications, 1975 , vol. 40, # 3 p. 719 - 737 |
| 5-chloro-2-(4-fluorophenylthio)benzoic acid |
| 2-(4-Fluorphenylthio)-5-chlorbenzoesaeure |
| 3-chloro-6-[(4'-fluorophenyl)-thio]-benzoic acid |
| Benzoic acid,5-chloro-2-[(4-fluorophenyl)thio] |