1H-Purine-2,6-dione,3,9-dihydro-9-phenyl- structure
|
Common Name | 1H-Purine-2,6-dione,3,9-dihydro-9-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5444-47-3 | Molecular Weight | 228.20700 | |
| Density | 1.58g/cm3 | Boiling Point | 600.5ºC at 760mmHg | |
| Molecular Formula | C11H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317ºC | |
| Name | 9-phenyl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 600.5ºC at 760mmHg |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.20700 |
| Flash Point | 317ºC |
| Exact Mass | 228.06500 |
| PSA | 83.54000 |
| LogP | 0.40210 |
| Index of Refraction | 1.782 |
| InChIKey | SMYATLOKIGVDEW-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2ncn(-c3ccccc3)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Phenyl-3,9-dihydro-purin-2,6-dion |
| Xanthine,9-phenyl |
| 9-phenyl-3,9-dihydro-purine-2,6-dione |
| 9-Phenyl-xanthin |
| 9-Phenyl-3,9-dihydro-1H-purine-2,6-dione |