2,6-dichloro-9-phenyl-purine structure
|
Common Name | 2,6-dichloro-9-phenyl-purine | ||
|---|---|---|---|---|
| CAS Number | 6971-26-2 | Molecular Weight | 265.09800 | |
| Density | 1.58g/cm3 | Boiling Point | 406.2ºC at 760 mmHg | |
| Molecular Formula | C11H6Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.5ºC | |
| Name | 2,6-dichloro-9-phenylpurine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 406.2ºC at 760 mmHg |
| Molecular Formula | C11H6Cl2N4 |
| Molecular Weight | 265.09800 |
| Flash Point | 199.5ºC |
| Exact Mass | 263.99700 |
| PSA | 43.60000 |
| LogP | 3.12230 |
| Index of Refraction | 1.743 |
| InChIKey | PUARFAPITOZVIH-UHFFFAOYSA-N |
| SMILES | Clc1nc(Cl)c2ncn(-c3ccccc3)c2n1 |
|
~%
2,6-dichloro-9-... CAS#:6971-26-2 |
| Literature: Merrell Dow Pharmaceuticals Inc. Patent: US5064947 A1, 1991 ; US 5064947 A |
|
~50%
2,6-dichloro-9-... CAS#:6971-26-2 |
| Literature: Bakkestuen, Anne Kristin; Gundersen, Lise-Lotte Tetrahedron Letters, 2003 , vol. 44, # 16 p. 3359 - 3362 |
|
~97%
2,6-dichloro-9-... CAS#:6971-26-2 |
| Literature: Niu, Hong-Ying; Xia, Chao; Qu, Gui-Rong; Zhang, Qian; Jiang, Yi; Mao, Run-Ze; Li, De-Yang; Guo, Hai-Ming Organic and Biomolecular Chemistry, 2011 , vol. 9, # 14 p. 5039 - 5042 |
|
~%
2,6-dichloro-9-... CAS#:6971-26-2 |
| Literature: Koppel; Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 2751,2753 |
| 2,6-dichloro-9-phenyl-9h-purine |
| HMS3095C20 |
| 2,6-dichloro-1-phenylpurine |
| 2,6-dichloro-9-(4-methylphenyl)-purine |
| 2,6-Dichlor-9-phenyl-9H-purin |