1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-3,1-benzoxazine-2,4-dione structure
|
Common Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-3,1-benzoxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 544418-04-4 | Molecular Weight | 623.26000 | |
| Density | 1.596g/cm3 | Boiling Point | 389ºC at 760 mmHg | |
| Molecular Formula | C19H10F17NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 189.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760 mmHg |
| Molecular Formula | C19H10F17NO3 |
| Molecular Weight | 623.26000 |
| Flash Point | 189.1ºC |
| Exact Mass | 623.03900 |
| PSA | 52.21000 |
| LogP | 6.74430 |
| Index of Refraction | 1.391 |
| InChIKey | JRKNOQQQWMFWME-UHFFFAOYSA-N |
| SMILES | O=c1oc(=O)n(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| 1-(1H,1H,2H,2H,3H,3H-Perfluoroundecyl)-3,1-benzoxazine-2,4(1H)-dione |
| 1-[3-(Perfluorooctyl)propyl]-3,1-benzoxazine-2,4(1H)-dione |
| MFCD03788347 |
| 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)-3,1-benzoxazine-2,4(1H)-dione |