ethyl 2-butyl-1-oxaspiro[2.5]octane-2-carboxylate structure
|
Common Name | ethyl 2-butyl-1-oxaspiro[2.5]octane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5445-41-0 | Molecular Weight | 240.33900 | |
| Density | 1.03g/cm3 | Boiling Point | 305.8ºC at 760 mmHg | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.6ºC | |
| Name | ethyl 2-butyl-1-oxaspiro[2.5]octane-2-carboxylate |
|---|
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 305.8ºC at 760 mmHg |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.33900 |
| Flash Point | 124.6ºC |
| Exact Mass | 240.17300 |
| PSA | 38.83000 |
| LogP | 3.21160 |
| Index of Refraction | 1.483 |
| InChIKey | SNHFRTAAHLOBQW-UHFFFAOYSA-N |
| SMILES | CCCCC1(C(=O)OCC)OC12CCCCC2 |
|
~%
ethyl 2-butyl-1... CAS#:5445-41-0 |
| Literature: Nelson; Morris Journal of the American Chemical Society, 1953 , vol. 75, p. 3337 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |