ethyl 2-heptyl-1-oxaspiro[2.5]octane-2-carboxylate structure
|
Common Name | ethyl 2-heptyl-1-oxaspiro[2.5]octane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7152-27-4 | Molecular Weight | 282.41800 | |
| Density | 1g/cm3 | Boiling Point | 354.3ºC at 760 mmHg | |
| Molecular Formula | C17H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.5ºC | |
| Name | ethyl 2-heptyl-1-oxaspiro[2.5]octane-2-carboxylate |
|---|
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 354.3ºC at 760 mmHg |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.41800 |
| Flash Point | 147.5ºC |
| Exact Mass | 282.21900 |
| PSA | 38.83000 |
| LogP | 4.38190 |
| Index of Refraction | 1.482 |
| InChIKey | WWFIFGLYRLMJII-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1(C(=O)OCC)OC12CCCCC2 |
|
~%
ethyl 2-heptyl-... CAS#:7152-27-4 |
| Literature: Morris; Lusth Journal of the American Chemical Society, 1954 , vol. 76, p. 1237,1239 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |